methyl (R)-2-chloropropionate


(+)-methyl (R)-2-chloropropionate; methyl (R)-2-chloropropionate
CAS RN:[77287-29-7]
Formula:C4H7ClO2; 122.55 g/mol
InChiKey:JLEJCNOTNLZCHQ-GSVOUGTGSA-N
SMILES:COC(=O)[C@@H](C)Cl
Molecular structure of methyl (R)-2-chloropropionate
Density:1.152 g/mL
Molar volume:106.4 mL/mol
Boiling point:133 °C

Isomers

2-chlorobutanoic acid
Molecular structure of 2-chlorobutanoic acid
3-chlorobutanoic acid
Molecular structure of 3-chlorobutanoic acid
4-chlorobutanoic acid
Molecular structure of 4-chlorobutanoic acid
2-chloroethyl acetate
Molecular structure of 2-chloroethyl acetate
2-chloromethyl-1,3-dioxolane
Molecular structure of 2-chloromethyl-1,3-dioxolane
2-chloro-2-methylpropanoic acid
Molecular structure of 2-chloro-2-methylpropanoic acid
ethyl chloroacetate
Molecular structure of ethyl chloroacetate
methyl (R)-2-chloropropionate
Molecular structure of methyl (R)-2-chloropropionate
methyl (S)-2-chloropropionate
Molecular structure of methyl (S)-2-chloropropionate
methyl 2-chloropropionate
Molecular structure of methyl 2-chloropropionate
propan-2-yl chloroformate
Molecular structure of propan-2-yl chloroformate
propyl chloroformate
Molecular structure of propyl chloroformate